About 3,4-dihydro-2H-thiochromene;N,N-dipropylhydroxylamine
3,4-dihydro-2H-thiochromene;N,N-dipropylhydroxylamine (PubChem CID 19770849) has the molecular formula C15H25NOS
and a molecular weight of 267.44 g/mol. Its IUPAC name is 3,4-dihydro-2H-thiochromene;N,N-dipropylhydroxylamine.
Molecular Properties
| Compound Name | 3,4-dihydro-2H-thiochromene;N,N-dipropylhydroxylamine |
| PubChem CID | 19770849 |
| Molecular Formula | C15H25NOS |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 3,4-dihydro-2H-thiochromene;N,N-dipropylhydroxylamine |
| SMILES | CCCN(O)CCC.c1ccc2c(c1)CCCS2 |
| InChI | InChI=1S/C9H10S.C6H15NO/c1-2-6-9-8(4-1)5-3-7-10-9;1-3-5-7(8)6-4-2/h1-2,4,6H,3,5,7H2;8H,3-6H2,1-2H3 |
| InChIKey | ARGVTHBNRKTIJF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dihydro-2H-thiochromene;N,N-dipropylhydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydro-2H-thiochromene;N,N-dipropylhydroxylamine?
The IUPAC name of 3,4-dihydro-2H-thiochromene;N,N-dipropylhydroxylamine (CID 19770849) is 3,4-dihydro-2H-thiochromene;N,N-dipropylhydroxylamine.
What is the SMILES notation for 3,4-dihydro-2H-thiochromene;N,N-dipropylhydroxylamine?
The canonical SMILES for 3,4-dihydro-2H-thiochromene;N,N-dipropylhydroxylamine is CCCN(O)CCC.c1ccc2c(c1)CCCS2.
What is the InChIKey of 3,4-dihydro-2H-thiochromene;N,N-dipropylhydroxylamine?
The InChIKey is ARGVTHBNRKTIJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10S.C6H15NO/c1-2-6-9-8(4-1)5-3-7-10-9;1-3-5-7(8)6-4-2/h1-2,4,6H,3,5,7H2;8H,3-6H2,1-2H3.
What are the key properties of 3,4-dihydro-2H-thiochromene;N,N-dipropylhydroxylamine?
3,4-dihydro-2H-thiochromene;N,N-dipropylhydroxylamine has a molecular weight of 267.44 g/mol, XLogP of 4.22, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-2H-thiochromene;N,N-dipropylhydroxylamine is sourced from PubChem (CID 19770849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).