About (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) pyrazolo[1,5-a]pyridine-3-carboxylate
(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) pyrazolo[1,5-a]pyridine-3-carboxylate (PubChem CID 19770958) has the molecular formula C16H19N3O2
and a molecular weight of 285.35 g/mol. Its IUPAC name is (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) pyrazolo[1,5-a]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) pyrazolo[1,5-a]pyridine-3-carboxylate |
| PubChem CID | 19770958 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) pyrazolo[1,5-a]pyridine-3-carboxylate |
| SMILES | CN1C2CCC1CC(OC(=O)c1cnn3ccccc13)C2 |
| InChI | InChI=1S/C16H19N3O2/c1-18-11-5-6-12(18)9-13(8-11)21-16(20)14-10-17-19-7-3-2-4-15(14)19/h2-4,7,10-13H,5-6,8-9H2,1H3 |
| InChIKey | OYMSVEYECKLFKC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) pyrazolo[1,5-a]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) pyrazolo[1,5-a]pyridine-3-carboxylate?
The IUPAC name of (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) pyrazolo[1,5-a]pyridine-3-carboxylate (CID 19770958) is (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) pyrazolo[1,5-a]pyridine-3-carboxylate.
What is the SMILES notation for (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) pyrazolo[1,5-a]pyridine-3-carboxylate?
The canonical SMILES for (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) pyrazolo[1,5-a]pyridine-3-carboxylate is CN1C2CCC1CC(OC(=O)c1cnn3ccccc13)C2.
What is the InChIKey of (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) pyrazolo[1,5-a]pyridine-3-carboxylate?
The InChIKey is OYMSVEYECKLFKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O2/c1-18-11-5-6-12(18)9-13(8-11)21-16(20)14-10-17-19-7-3-2-4-15(14)19/h2-4,7,10-13H,5-6,8-9H2,1H3.
What are the key properties of (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) pyrazolo[1,5-a]pyridine-3-carboxylate?
(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) pyrazolo[1,5-a]pyridine-3-carboxylate has a molecular weight of 285.35 g/mol, XLogP of 2.12, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) pyrazolo[1,5-a]pyridine-3-carboxylate is sourced from PubChem (CID 19770958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).