About 5-(tetrazol-1-ylmethyl)-1,3-oxazole
5-(tetrazol-1-ylmethyl)-1,3-oxazole (PubChem CID 19771040) has the molecular formula C5H5N5O
and a molecular weight of 151.13 g/mol. Its IUPAC name is 5-(tetrazol-1-ylmethyl)-1,3-oxazole.
Molecular Properties
| Compound Name | 5-(tetrazol-1-ylmethyl)-1,3-oxazole |
| PubChem CID | 19771040 |
| Molecular Formula | C5H5N5O |
| Molecular Weight | 151.13 g/mol |
| Exact Mass | 151.05 |
| IUPAC Name | 5-(tetrazol-1-ylmethyl)-1,3-oxazole |
| SMILES | c1ncc(Cn2cnnn2)o1 |
| InChI | InChI=1S/C5H5N5O/c1-5(11-4-6-1)2-10-3-7-8-9-10/h1,3-4H,2H2 |
| InChIKey | CVQMLSXXNALVEC-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.13 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(tetrazol-1-ylmethyl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(tetrazol-1-ylmethyl)-1,3-oxazole?
The IUPAC name of 5-(tetrazol-1-ylmethyl)-1,3-oxazole (CID 19771040) is 5-(tetrazol-1-ylmethyl)-1,3-oxazole.
What is the SMILES notation for 5-(tetrazol-1-ylmethyl)-1,3-oxazole?
The canonical SMILES for 5-(tetrazol-1-ylmethyl)-1,3-oxazole is c1ncc(Cn2cnnn2)o1.
What is the InChIKey of 5-(tetrazol-1-ylmethyl)-1,3-oxazole?
The InChIKey is CVQMLSXXNALVEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N5O/c1-5(11-4-6-1)2-10-3-7-8-9-10/h1,3-4H,2H2.
What are the key properties of 5-(tetrazol-1-ylmethyl)-1,3-oxazole?
5-(tetrazol-1-ylmethyl)-1,3-oxazole has a molecular weight of 151.13 g/mol, XLogP of -0.29, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(tetrazol-1-ylmethyl)-1,3-oxazole is sourced from PubChem (CID 19771040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).