C13H17F13O2Si — CID 19771209
hydroxy-dimethyl-[3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)propyl]silane (PubChem CID 19771209) has the molecular formula C13H17F13O2Si and a molecular weight of 480.34 g/mol. Its IUPAC name is hydroxy-dimethyl-[3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)propyl]silane.
| Compound Name | hydroxy-dimethyl-[3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)propyl]silane |
|---|---|
| PubChem CID | 19771209 |
| Molecular Formula | C13H17F13O2Si |
| Molecular Weight | 480.34 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | hydroxy-dimethyl-[3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)propyl]silane |
| SMILES | C[Si](C)(O)CCCOCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H17F13O2Si/c1-29(2,27)7-3-5-28-6-4-8(14,15)9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)26/h27H,3-7H2,1-2H3 |
| InChIKey | ZBHKSQLXWSTNSJ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.34 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|