C7H5F11OS — CID 19771219
3,3,4,4-tetrafluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)butane-1-thiol (PubChem CID 19771219) has the molecular formula C7H5F11OS and a molecular weight of 346.16 g/mol. Its IUPAC name is 3,3,4,4-tetrafluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)butane-1-thiol.
| Compound Name | 3,3,4,4-tetrafluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)butane-1-thiol |
|---|---|
| PubChem CID | 19771219 |
| Molecular Formula | C7H5F11OS |
| Molecular Weight | 346.16 g/mol |
| Exact Mass | 345.99 |
| IUPAC Name | 3,3,4,4-tetrafluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)butane-1-thiol |
| SMILES | FC(F)(F)C(F)(OC(F)(F)C(F)(F)CCS)C(F)(F)F |
| InChI | InChI=1S/C7H5F11OS/c8-3(9,1-2-20)7(17,18)19-4(10,5(11,12)13)6(14,15)16/h20H,1-2H2 |
| InChIKey | NSSQBKISOKDJOK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.16 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|