C7H12N2O — CID 19771285
4-methyl-1,2,3,6-tetrahydropyridine-3-carboxamide (PubChem CID 19771285) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is 4-methyl-1,2,3,6-tetrahydropyridine-3-carboxamide.
| Compound Name | 4-methyl-1,2,3,6-tetrahydropyridine-3-carboxamide |
|---|---|
| PubChem CID | 19771285 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 4-methyl-1,2,3,6-tetrahydropyridine-3-carboxamide |
| SMILES | CC1=CCNCC1C(N)=O |
| InChI | InChI=1S/C7H12N2O/c1-5-2-3-9-4-6(5)7(8)10/h2,6,9H,3-4H2,1H3,(H2,8,10) |
| InChIKey | QVDAJIMTMKDFCE-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|