About 2-ethyl-6,8-dihydro-5H-pyrano[3,4-b]pyran-4-one
2-ethyl-6,8-dihydro-5H-pyrano[3,4-b]pyran-4-one (PubChem CID 19771709) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is 2-ethyl-6,8-dihydro-5H-pyrano[3,4-b]pyran-4-one.
Molecular Properties
| Compound Name | 2-ethyl-6,8-dihydro-5H-pyrano[3,4-b]pyran-4-one |
| PubChem CID | 19771709 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 2-ethyl-6,8-dihydro-5H-pyrano[3,4-b]pyran-4-one |
| SMILES | CCc1cc(=O)c2c(o1)COCC2 |
| InChI | InChI=1S/C10H12O3/c1-2-7-5-9(11)8-3-4-12-6-10(8)13-7/h5H,2-4,6H2,1H3 |
| InChIKey | UNIKDHFYWQHZHX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-6,8-dihydro-5H-pyrano[3,4-b]pyran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-6,8-dihydro-5H-pyrano[3,4-b]pyran-4-one?
The IUPAC name of 2-ethyl-6,8-dihydro-5H-pyrano[3,4-b]pyran-4-one (CID 19771709) is 2-ethyl-6,8-dihydro-5H-pyrano[3,4-b]pyran-4-one.
What is the SMILES notation for 2-ethyl-6,8-dihydro-5H-pyrano[3,4-b]pyran-4-one?
The canonical SMILES for 2-ethyl-6,8-dihydro-5H-pyrano[3,4-b]pyran-4-one is CCc1cc(=O)c2c(o1)COCC2.
What is the InChIKey of 2-ethyl-6,8-dihydro-5H-pyrano[3,4-b]pyran-4-one?
The InChIKey is UNIKDHFYWQHZHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-2-7-5-9(11)8-3-4-12-6-10(8)13-7/h5H,2-4,6H2,1H3.
What are the key properties of 2-ethyl-6,8-dihydro-5H-pyrano[3,4-b]pyran-4-one?
2-ethyl-6,8-dihydro-5H-pyrano[3,4-b]pyran-4-one has a molecular weight of 180.20 g/mol, XLogP of 1.27, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-6,8-dihydro-5H-pyrano[3,4-b]pyran-4-one is sourced from PubChem (CID 19771709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).