C12H13F3N2O2 — CID 19771738
2-ethyl-5-(2,2,2-trifluoroacetyl)-1,6,7,8-tetrahydro-1,5-naphthyridin-4-one (PubChem CID 19771738) has the molecular formula C12H13F3N2O2 and a molecular weight of 274.24 g/mol. Its IUPAC name is 2-ethyl-5-(2,2,2-trifluoroacetyl)-1,6,7,8-tetrahydro-1,5-naphthyridin-4-one.
| Compound Name | 2-ethyl-5-(2,2,2-trifluoroacetyl)-1,6,7,8-tetrahydro-1,5-naphthyridin-4-one |
|---|---|
| PubChem CID | 19771738 |
| Molecular Formula | C12H13F3N2O2 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 2-ethyl-5-(2,2,2-trifluoroacetyl)-1,6,7,8-tetrahydro-1,5-naphthyridin-4-one |
| SMILES | CCc1cc(=O)c2c([nH]1)CCCN2C(=O)C(F)(F)F |
| InChI | InChI=1S/C12H13F3N2O2/c1-2-7-6-9(18)10-8(16-7)4-3-5-17(10)11(19)12(13,14)15/h6H,2-5H2,1H3,(H,16,18) |
| InChIKey | PTUCZGOFDHSUMV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |