About 2-sulfanylidene-1,2-benzodiazepin-2-ium
2-sulfanylidene-1,2-benzodiazepin-2-ium (PubChem CID 19771753) has the molecular formula C9H7N2S+
and a molecular weight of 175.24 g/mol. Its IUPAC name is 2-sulfanylidene-1,2-benzodiazepin-2-ium.
Molecular Properties
| Compound Name | 2-sulfanylidene-1,2-benzodiazepin-2-ium |
| PubChem CID | 19771753 |
| Molecular Formula | C9H7N2S+ |
| Molecular Weight | 175.24 g/mol |
| Exact Mass | 175.03 |
| IUPAC Name | 2-sulfanylidene-1,2-benzodiazepin-2-ium |
| SMILES | S=[n+]1cccc2ccccc2n1 |
| InChI | InChI=1S/C9H7N2S/c12-11-7-3-5-8-4-1-2-6-9(8)10-11/h1-7H/q+1 |
| InChIKey | KXGMODWGAZINFW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 18.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.24 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanylidene-1,2-benzodiazepin-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanylidene-1,2-benzodiazepin-2-ium?
The IUPAC name of 2-sulfanylidene-1,2-benzodiazepin-2-ium (CID 19771753) is 2-sulfanylidene-1,2-benzodiazepin-2-ium.
What is the SMILES notation for 2-sulfanylidene-1,2-benzodiazepin-2-ium?
The canonical SMILES for 2-sulfanylidene-1,2-benzodiazepin-2-ium is S=[n+]1cccc2ccccc2n1.
What is the InChIKey of 2-sulfanylidene-1,2-benzodiazepin-2-ium?
The InChIKey is KXGMODWGAZINFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N2S/c12-11-7-3-5-8-4-1-2-6-9(8)10-11/h1-7H/q+1.
What are the key properties of 2-sulfanylidene-1,2-benzodiazepin-2-ium?
2-sulfanylidene-1,2-benzodiazepin-2-ium has a molecular weight of 175.24 g/mol, XLogP of 1.76, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanylidene-1,2-benzodiazepin-2-ium is sourced from PubChem (CID 19771753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).