C12H12N2O4S — CID 19772331
2,3-dioxo-6,7,8,9-tetrahydro-1H-benzo[g]indole-5-sulfonamide (PubChem CID 19772331) has the molecular formula C12H12N2O4S and a molecular weight of 280.30 g/mol. Its IUPAC name is 2,3-dioxo-6,7,8,9-tetrahydro-1H-benzo[g]indole-5-sulfonamide.
| Compound Name | 2,3-dioxo-6,7,8,9-tetrahydro-1H-benzo[g]indole-5-sulfonamide |
|---|---|
| PubChem CID | 19772331 |
| Molecular Formula | C12H12N2O4S |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 2,3-dioxo-6,7,8,9-tetrahydro-1H-benzo[g]indole-5-sulfonamide |
| SMILES | NS(=O)(=O)c1cc2c(c3c1CCCC3)NC(=O)C2=O |
| InChI | InChI=1S/C12H12N2O4S/c13-19(17,18)9-5-8-10(14-12(16)11(8)15)7-4-2-1-3-6(7)9/h5H,1-4H2,(H2,13,17,18)(H,14,15,16) |
| InChIKey | BQGPHZPJTJPZLM-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|