About 3-phenyl-1,2-dihydrotriazole-5-thiol
3-phenyl-1,2-dihydrotriazole-5-thiol (PubChem CID 19772910) has the molecular formula C8H9N3S
and a molecular weight of 179.25 g/mol. Its IUPAC name is 3-phenyl-1,2-dihydrotriazole-5-thiol.
Molecular Properties
| Compound Name | 3-phenyl-1,2-dihydrotriazole-5-thiol |
| PubChem CID | 19772910 |
| Molecular Formula | C8H9N3S |
| Molecular Weight | 179.25 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | 3-phenyl-1,2-dihydrotriazole-5-thiol |
| SMILES | SC1=CN(c2ccccc2)NN1 |
| InChI | InChI=1S/C8H9N3S/c12-8-6-11(10-9-8)7-4-2-1-3-5-7/h1-6,9-10,12H |
| InChIKey | ZEMMCUCDRPNYJP-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.25 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-phenyl-1,2-dihydrotriazole-5-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-1,2-dihydrotriazole-5-thiol?
The IUPAC name of 3-phenyl-1,2-dihydrotriazole-5-thiol (CID 19772910) is 3-phenyl-1,2-dihydrotriazole-5-thiol.
What is the SMILES notation for 3-phenyl-1,2-dihydrotriazole-5-thiol?
The canonical SMILES for 3-phenyl-1,2-dihydrotriazole-5-thiol is SC1=CN(c2ccccc2)NN1.
What is the InChIKey of 3-phenyl-1,2-dihydrotriazole-5-thiol?
The InChIKey is ZEMMCUCDRPNYJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3S/c12-8-6-11(10-9-8)7-4-2-1-3-5-7/h1-6,9-10,12H.
What are the key properties of 3-phenyl-1,2-dihydrotriazole-5-thiol?
3-phenyl-1,2-dihydrotriazole-5-thiol has a molecular weight of 179.25 g/mol, XLogP of 1.24, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-1,2-dihydrotriazole-5-thiol is sourced from PubChem (CID 19772910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).