About 4-methoxycyclohexa-1,3-diene-1-carboxamide
4-methoxycyclohexa-1,3-diene-1-carboxamide (PubChem CID 19773130) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is 4-methoxycyclohexa-1,3-diene-1-carboxamide.
Molecular Properties
| Compound Name | 4-methoxycyclohexa-1,3-diene-1-carboxamide |
| PubChem CID | 19773130 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 4-methoxycyclohexa-1,3-diene-1-carboxamide |
| SMILES | COC1=CC=C(C(N)=O)CC1 |
| InChI | InChI=1S/C8H11NO2/c1-11-7-4-2-6(3-5-7)8(9)10/h2,4H,3,5H2,1H3,(H2,9,10) |
| InChIKey | YWBOLCUMQASHJU-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methoxycyclohexa-1,3-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxycyclohexa-1,3-diene-1-carboxamide?
The IUPAC name of 4-methoxycyclohexa-1,3-diene-1-carboxamide (CID 19773130) is 4-methoxycyclohexa-1,3-diene-1-carboxamide.
What is the SMILES notation for 4-methoxycyclohexa-1,3-diene-1-carboxamide?
The canonical SMILES for 4-methoxycyclohexa-1,3-diene-1-carboxamide is COC1=CC=C(C(N)=O)CC1.
What is the InChIKey of 4-methoxycyclohexa-1,3-diene-1-carboxamide?
The InChIKey is YWBOLCUMQASHJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2/c1-11-7-4-2-6(3-5-7)8(9)10/h2,4H,3,5H2,1H3,(H2,9,10).
What are the key properties of 4-methoxycyclohexa-1,3-diene-1-carboxamide?
4-methoxycyclohexa-1,3-diene-1-carboxamide has a molecular weight of 153.18 g/mol, XLogP of 0.72, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxycyclohexa-1,3-diene-1-carboxamide is sourced from PubChem (CID 19773130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).