About N-(6-hydroxy-1-methylcyclohexa-2,4-dien-1-yl)acetamide
N-(6-hydroxy-1-methylcyclohexa-2,4-dien-1-yl)acetamide (PubChem CID 19773492) has the molecular formula C9H13NO2
and a molecular weight of 167.21 g/mol. Its IUPAC name is N-(6-hydroxy-1-methylcyclohexa-2,4-dien-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(6-hydroxy-1-methylcyclohexa-2,4-dien-1-yl)acetamide |
| PubChem CID | 19773492 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | N-(6-hydroxy-1-methylcyclohexa-2,4-dien-1-yl)acetamide |
| SMILES | CC(=O)NC1(C)C=CC=CC1O |
| InChI | InChI=1S/C9H13NO2/c1-7(11)10-9(2)6-4-3-5-8(9)12/h3-6,8,12H,1-2H3,(H,10,11) |
| InChIKey | PPISPJWYUBABNH-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(6-hydroxy-1-methylcyclohexa-2,4-dien-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-hydroxy-1-methylcyclohexa-2,4-dien-1-yl)acetamide?
The IUPAC name of N-(6-hydroxy-1-methylcyclohexa-2,4-dien-1-yl)acetamide (CID 19773492) is N-(6-hydroxy-1-methylcyclohexa-2,4-dien-1-yl)acetamide.
What is the SMILES notation for N-(6-hydroxy-1-methylcyclohexa-2,4-dien-1-yl)acetamide?
The canonical SMILES for N-(6-hydroxy-1-methylcyclohexa-2,4-dien-1-yl)acetamide is CC(=O)NC1(C)C=CC=CC1O.
What is the InChIKey of N-(6-hydroxy-1-methylcyclohexa-2,4-dien-1-yl)acetamide?
The InChIKey is PPISPJWYUBABNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2/c1-7(11)10-9(2)6-4-3-5-8(9)12/h3-6,8,12H,1-2H3,(H,10,11).
What are the key properties of N-(6-hydroxy-1-methylcyclohexa-2,4-dien-1-yl)acetamide?
N-(6-hydroxy-1-methylcyclohexa-2,4-dien-1-yl)acetamide has a molecular weight of 167.21 g/mol, XLogP of 0.37, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-hydroxy-1-methylcyclohexa-2,4-dien-1-yl)acetamide is sourced from PubChem (CID 19773492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).