About 4-(2-ethyl-1,3-thiazol-4-yl)phenol
4-(2-ethyl-1,3-thiazol-4-yl)phenol (PubChem CID 19773531) has the molecular formula C11H11NOS
and a molecular weight of 205.28 g/mol. Its IUPAC name is 4-(2-ethyl-1,3-thiazol-4-yl)phenol.
Molecular Properties
| Compound Name | 4-(2-ethyl-1,3-thiazol-4-yl)phenol |
| PubChem CID | 19773531 |
| Molecular Formula | C11H11NOS |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 4-(2-ethyl-1,3-thiazol-4-yl)phenol |
| SMILES | CCc1nc(-c2ccc(O)cc2)cs1 |
| InChI | InChI=1S/C11H11NOS/c1-2-11-12-10(7-14-11)8-3-5-9(13)6-4-8/h3-7,13H,2H2,1H3 |
| InChIKey | FOPSDNOEPATHFE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-ethyl-1,3-thiazol-4-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-ethyl-1,3-thiazol-4-yl)phenol?
The IUPAC name of 4-(2-ethyl-1,3-thiazol-4-yl)phenol (CID 19773531) is 4-(2-ethyl-1,3-thiazol-4-yl)phenol.
What is the SMILES notation for 4-(2-ethyl-1,3-thiazol-4-yl)phenol?
The canonical SMILES for 4-(2-ethyl-1,3-thiazol-4-yl)phenol is CCc1nc(-c2ccc(O)cc2)cs1.
What is the InChIKey of 4-(2-ethyl-1,3-thiazol-4-yl)phenol?
The InChIKey is FOPSDNOEPATHFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NOS/c1-2-11-12-10(7-14-11)8-3-5-9(13)6-4-8/h3-7,13H,2H2,1H3.
What are the key properties of 4-(2-ethyl-1,3-thiazol-4-yl)phenol?
4-(2-ethyl-1,3-thiazol-4-yl)phenol has a molecular weight of 205.28 g/mol, XLogP of 3.08, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-ethyl-1,3-thiazol-4-yl)phenol is sourced from PubChem (CID 19773531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).