About 5-(4-aminophenyl)-1,1,1-trifluoropentan-2-ol
5-(4-aminophenyl)-1,1,1-trifluoropentan-2-ol (PubChem CID 19773665) has the molecular formula C11H14F3NO
and a molecular weight of 233.23 g/mol. Its IUPAC name is 5-(4-aminophenyl)-1,1,1-trifluoropentan-2-ol.
Molecular Properties
| Compound Name | 5-(4-aminophenyl)-1,1,1-trifluoropentan-2-ol |
| PubChem CID | 19773665 |
| Molecular Formula | C11H14F3NO |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 5-(4-aminophenyl)-1,1,1-trifluoropentan-2-ol |
| SMILES | Nc1ccc(CCCC(O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H14F3NO/c12-11(13,14)10(16)3-1-2-8-4-6-9(15)7-5-8/h4-7,10,16H,1-3,15H2 |
| InChIKey | ZROMSNJVZWHGLJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-aminophenyl)-1,1,1-trifluoropentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-aminophenyl)-1,1,1-trifluoropentan-2-ol?
The IUPAC name of 5-(4-aminophenyl)-1,1,1-trifluoropentan-2-ol (CID 19773665) is 5-(4-aminophenyl)-1,1,1-trifluoropentan-2-ol.
What is the SMILES notation for 5-(4-aminophenyl)-1,1,1-trifluoropentan-2-ol?
The canonical SMILES for 5-(4-aminophenyl)-1,1,1-trifluoropentan-2-ol is Nc1ccc(CCCC(O)C(F)(F)F)cc1.
What is the InChIKey of 5-(4-aminophenyl)-1,1,1-trifluoropentan-2-ol?
The InChIKey is ZROMSNJVZWHGLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F3NO/c12-11(13,14)10(16)3-1-2-8-4-6-9(15)7-5-8/h4-7,10,16H,1-3,15H2.
What are the key properties of 5-(4-aminophenyl)-1,1,1-trifluoropentan-2-ol?
5-(4-aminophenyl)-1,1,1-trifluoropentan-2-ol has a molecular weight of 233.23 g/mol, XLogP of 2.51, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-aminophenyl)-1,1,1-trifluoropentan-2-ol is sourced from PubChem (CID 19773665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).