About 2-(aziridin-1-yl)-4,5-dihydro-1,3-oxazole
2-(aziridin-1-yl)-4,5-dihydro-1,3-oxazole (PubChem CID 19773895) has the molecular formula C5H8N2O
and a molecular weight of 112.13 g/mol. Its IUPAC name is 2-(aziridin-1-yl)-4,5-dihydro-1,3-oxazole.
Molecular Properties
| Compound Name | 2-(aziridin-1-yl)-4,5-dihydro-1,3-oxazole |
| PubChem CID | 19773895 |
| Molecular Formula | C5H8N2O |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.06 |
| IUPAC Name | 2-(aziridin-1-yl)-4,5-dihydro-1,3-oxazole |
| SMILES | C1COC(N2CC2)=N1 |
| InChI | InChI=1S/C5H8N2O/c1-4-8-5(6-1)7-2-3-7/h1-4H2 |
| InChIKey | SUUSNDZEWZWPSK-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 24.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(aziridin-1-yl)-4,5-dihydro-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aziridin-1-yl)-4,5-dihydro-1,3-oxazole?
The IUPAC name of 2-(aziridin-1-yl)-4,5-dihydro-1,3-oxazole (CID 19773895) is 2-(aziridin-1-yl)-4,5-dihydro-1,3-oxazole.
What is the SMILES notation for 2-(aziridin-1-yl)-4,5-dihydro-1,3-oxazole?
The canonical SMILES for 2-(aziridin-1-yl)-4,5-dihydro-1,3-oxazole is C1COC(N2CC2)=N1.
What is the InChIKey of 2-(aziridin-1-yl)-4,5-dihydro-1,3-oxazole?
The InChIKey is SUUSNDZEWZWPSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O/c1-4-8-5(6-1)7-2-3-7/h1-4H2.
What are the key properties of 2-(aziridin-1-yl)-4,5-dihydro-1,3-oxazole?
2-(aziridin-1-yl)-4,5-dihydro-1,3-oxazole has a molecular weight of 112.13 g/mol, XLogP of -0.31, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aziridin-1-yl)-4,5-dihydro-1,3-oxazole is sourced from PubChem (CID 19773895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).