C12H17ClN2O — CID 19774158
3-[(4-chloro-5,6,7,8-tetrahydroquinolin-7-yl)amino]propan-1-ol (PubChem CID 19774158) has the molecular formula C12H17ClN2O and a molecular weight of 240.73 g/mol. Its IUPAC name is 3-[(4-chloro-5,6,7,8-tetrahydroquinolin-7-yl)amino]propan-1-ol.
| Compound Name | 3-[(4-chloro-5,6,7,8-tetrahydroquinolin-7-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 19774158 |
| Molecular Formula | C12H17ClN2O |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 3-[(4-chloro-5,6,7,8-tetrahydroquinolin-7-yl)amino]propan-1-ol |
| SMILES | OCCCNC1CCc2c(Cl)ccnc2C1 |
| InChI | InChI=1S/C12H17ClN2O/c13-11-4-6-15-12-8-9(2-3-10(11)12)14-5-1-7-16/h4,6,9,14,16H,1-3,5,7-8H2 |
| InChIKey | CAKSPTRPPGJDEX-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|