About 3-[5-(2,4-dichlorophenyl)-2-methoxy-2-methyl-4-propan-2-yl-1,3-dioxolan-4-yl]pyridine
3-[5-(2,4-dichlorophenyl)-2-methoxy-2-methyl-4-propan-2-yl-1,3-dioxolan-4-yl]pyridine (PubChem CID 19774205) has the molecular formula C19H21Cl2NO3
and a molecular weight of 382.29 g/mol. Its IUPAC name is 3-[5-(2,4-dichlorophenyl)-2-methoxy-2-methyl-4-propan-2-yl-1,3-dioxolan-4-yl]pyridine.
Molecular Properties
| Compound Name | 3-[5-(2,4-dichlorophenyl)-2-methoxy-2-methyl-4-propan-2-yl-1,3-dioxolan-4-yl]pyridine |
| PubChem CID | 19774205 |
| Molecular Formula | C19H21Cl2NO3 |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 3-[5-(2,4-dichlorophenyl)-2-methoxy-2-methyl-4-propan-2-yl-1,3-dioxolan-4-yl]pyridine |
| SMILES | COC1(C)OC(c2ccc(Cl)cc2Cl)C(c2cccnc2)(C(C)C)O1 |
| InChI | InChI=1S/C19H21Cl2NO3/c1-12(2)19(13-6-5-9-22-11-13)17(24-18(3,23-4)25-19)15-8-7-14(20)10-16(15)21/h5-12,17H,1-4H3 |
| InChIKey | ALESTTGFURXXNR-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[5-(2,4-dichlorophenyl)-2-methoxy-2-methyl-4-propan-2-yl-1,3-dioxolan-4-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(2,4-dichlorophenyl)-2-methoxy-2-methyl-4-propan-2-yl-1,3-dioxolan-4-yl]pyridine?
The IUPAC name of 3-[5-(2,4-dichlorophenyl)-2-methoxy-2-methyl-4-propan-2-yl-1,3-dioxolan-4-yl]pyridine (CID 19774205) is 3-[5-(2,4-dichlorophenyl)-2-methoxy-2-methyl-4-propan-2-yl-1,3-dioxolan-4-yl]pyridine.
What is the SMILES notation for 3-[5-(2,4-dichlorophenyl)-2-methoxy-2-methyl-4-propan-2-yl-1,3-dioxolan-4-yl]pyridine?
The canonical SMILES for 3-[5-(2,4-dichlorophenyl)-2-methoxy-2-methyl-4-propan-2-yl-1,3-dioxolan-4-yl]pyridine is COC1(C)OC(c2ccc(Cl)cc2Cl)C(c2cccnc2)(C(C)C)O1.
What is the InChIKey of 3-[5-(2,4-dichlorophenyl)-2-methoxy-2-methyl-4-propan-2-yl-1,3-dioxolan-4-yl]pyridine?
The InChIKey is ALESTTGFURXXNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21Cl2NO3/c1-12(2)19(13-6-5-9-22-11-13)17(24-18(3,23-4)25-19)15-8-7-14(20)10-16(15)21/h5-12,17H,1-4H3.
What are the key properties of 3-[5-(2,4-dichlorophenyl)-2-methoxy-2-methyl-4-propan-2-yl-1,3-dioxolan-4-yl]pyridine?
3-[5-(2,4-dichlorophenyl)-2-methoxy-2-methyl-4-propan-2-yl-1,3-dioxolan-4-yl]pyridine has a molecular weight of 382.29 g/mol, XLogP of 5.35, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(2,4-dichlorophenyl)-2-methoxy-2-methyl-4-propan-2-yl-1,3-dioxolan-4-yl]pyridine is sourced from PubChem (CID 19774205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).