C17H14BrFO3 — CID 19774216
(4-bromo-5-hydroxy-2,3,4,5-tetrahydro-1-benzoxepin-7-yl)-(2-fluorophenyl)methanone (PubChem CID 19774216) has the molecular formula C17H14BrFO3 and a molecular weight of 365.20 g/mol. Its IUPAC name is (4-bromo-5-hydroxy-2,3,4,5-tetrahydro-1-benzoxepin-7-yl)-(2-fluorophenyl)methanone.
| Compound Name | (4-bromo-5-hydroxy-2,3,4,5-tetrahydro-1-benzoxepin-7-yl)-(2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 19774216 |
| Molecular Formula | C17H14BrFO3 |
| Molecular Weight | 365.20 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | (4-bromo-5-hydroxy-2,3,4,5-tetrahydro-1-benzoxepin-7-yl)-(2-fluorophenyl)methanone |
| SMILES | O=C(c1ccc2c(c1)C(O)C(Br)CCO2)c1ccccc1F |
| InChI | InChI=1S/C17H14BrFO3/c18-13-7-8-22-15-6-5-10(9-12(15)17(13)21)16(20)11-3-1-2-4-14(11)19/h1-6,9,13,17,21H,7-8H2 |
| InChIKey | AFDDWTSUHXWFLK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.20 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|