C13H4F10N2O4 — CID 19774365
1-[5-(2,5-dioxopyrrol-1-yl)-1,1,2,2,3,3,4,4,5,5-decafluoropentyl]pyrrole-2,5-dione (PubChem CID 19774365) has the molecular formula C13H4F10N2O4 and a molecular weight of 442.17 g/mol. Its IUPAC name is 1-[5-(2,5-dioxopyrrol-1-yl)-1,1,2,2,3,3,4,4,5,5-decafluoropentyl]pyrrole-2,5-dione.
| Compound Name | 1-[5-(2,5-dioxopyrrol-1-yl)-1,1,2,2,3,3,4,4,5,5-decafluoropentyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 19774365 |
| Molecular Formula | C13H4F10N2O4 |
| Molecular Weight | 442.17 g/mol |
| Exact Mass | 442.00 |
| IUPAC Name | 1-[5-(2,5-dioxopyrrol-1-yl)-1,1,2,2,3,3,4,4,5,5-decafluoropentyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C13H4F10N2O4/c14-9(15,10(16,17)12(20,21)24-5(26)1-2-6(24)27)11(18,19)13(22,23)25-7(28)3-4-8(25)29/h1-4H |
| InChIKey | XUAZHUOFRABCSY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.17 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|