About propane-1-sulfonate;triethylazanium
propane-1-sulfonate;triethylazanium (PubChem CID 19774869) has the molecular formula C9H23NO3S
and a molecular weight of 225.35 g/mol. Its IUPAC name is propane-1-sulfonate;triethylazanium.
Molecular Properties
| Compound Name | propane-1-sulfonate;triethylazanium |
| PubChem CID | 19774869 |
| Molecular Formula | C9H23NO3S |
| Molecular Weight | 225.35 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | propane-1-sulfonate;triethylazanium |
| SMILES | CCCS(=O)(=O)[O-].CC[NH+](CC)CC |
| InChI | InChI=1S/C6H15N.C3H8O3S/c1-4-7(5-2)6-3;1-2-3-7(4,5)6/h4-6H2,1-3H3;2-3H2,1H3,(H,4,5,6) |
| InChIKey | ZMBMJGUGOYKRCX-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 61.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.35 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze propane-1-sulfonate;triethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane-1-sulfonate;triethylazanium?
The IUPAC name of propane-1-sulfonate;triethylazanium (CID 19774869) is propane-1-sulfonate;triethylazanium.
What is the SMILES notation for propane-1-sulfonate;triethylazanium?
The canonical SMILES for propane-1-sulfonate;triethylazanium is CCCS(=O)(=O)[O-].CC[NH+](CC)CC.
What is the InChIKey of propane-1-sulfonate;triethylazanium?
The InChIKey is ZMBMJGUGOYKRCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C3H8O3S/c1-4-7(5-2)6-3;1-2-3-7(4,5)6/h4-6H2,1-3H3;2-3H2,1H3,(H,4,5,6).
What are the key properties of propane-1-sulfonate;triethylazanium?
propane-1-sulfonate;triethylazanium has a molecular weight of 225.35 g/mol, XLogP of -0.13, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propane-1-sulfonate;triethylazanium is sourced from PubChem (CID 19774869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).