C19H31NO5 — CID 19775783
3-[[1-(2-carboxypentyl)cyclopentanecarbonyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 19775783) has the molecular formula C19H31NO5 and a molecular weight of 353.46 g/mol. Its IUPAC name is 3-[[1-(2-carboxypentyl)cyclopentanecarbonyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 3-[[1-(2-carboxypentyl)cyclopentanecarbonyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 19775783 |
| Molecular Formula | C19H31NO5 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | 3-[[1-(2-carboxypentyl)cyclopentanecarbonyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | CCCC(CC1(C(=O)NC2CCCC(C(=O)O)C2)CCCC1)C(=O)O |
| InChI | InChI=1S/C19H31NO5/c1-2-6-14(17(23)24)12-19(9-3-4-10-19)18(25)20-15-8-5-7-13(11-15)16(21)22/h13-15H,2-12H2,1H3,(H,20,25)(H,21,22)(H,23,24) |
| InChIKey | NWOSWWFBSMYTEO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |