C20H34N2O5 — CID 19775801
4-[[1-(6-amino-2-carboxyhexyl)cyclopentanecarbonyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 19775801) has the molecular formula C20H34N2O5 and a molecular weight of 382.50 g/mol. Its IUPAC name is 4-[[1-(6-amino-2-carboxyhexyl)cyclopentanecarbonyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[1-(6-amino-2-carboxyhexyl)cyclopentanecarbonyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 19775801 |
| Molecular Formula | C20H34N2O5 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | 4-[[1-(6-amino-2-carboxyhexyl)cyclopentanecarbonyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | NCCCCC(CC1(C(=O)NC2CCC(C(=O)O)CC2)CCCC1)C(=O)O |
| InChI | InChI=1S/C20H34N2O5/c21-12-4-1-5-15(18(25)26)13-20(10-2-3-11-20)19(27)22-16-8-6-14(7-9-16)17(23)24/h14-16H,1-13,21H2,(H,22,27)(H,23,24)(H,25,26) |
| InChIKey | FLLJSHQLWAGEIC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|