About 2-[6-[1,4-dimethyl-5-(trifluoromethyl)pyrazol-3-yl]oxybenzotriazol-1-yl]propanoate
2-[6-[1,4-dimethyl-5-(trifluoromethyl)pyrazol-3-yl]oxybenzotriazol-1-yl]propanoate (PubChem CID 19775933) has the molecular formula C15H13F3N5O3-
and a molecular weight of 368.30 g/mol. Its IUPAC name is 2-[6-[1,4-dimethyl-5-(trifluoromethyl)pyrazol-3-yl]oxybenzotriazol-1-yl]propanoate.
Molecular Properties
| Compound Name | 2-[6-[1,4-dimethyl-5-(trifluoromethyl)pyrazol-3-yl]oxybenzotriazol-1-yl]propanoate |
| PubChem CID | 19775933 |
| Molecular Formula | C15H13F3N5O3- |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 2-[6-[1,4-dimethyl-5-(trifluoromethyl)pyrazol-3-yl]oxybenzotriazol-1-yl]propanoate |
| SMILES | Cc1c(Oc2ccc3nnn(C(C)C(=O)[O-])c3c2)nn(C)c1C(F)(F)F |
| InChI | InChI=1S/C15H14F3N5O3/c1-7-12(15(16,17)18)22(3)20-13(7)26-9-4-5-10-11(6-9)23(21-19-10)8(2)14(24)25/h4-6,8H,1-3H3,(H,24,25)/p-1 |
| InChIKey | JEQXDBUZNVEMPN-UHFFFAOYSA-M |
| XLogP | 1.60 |
| TPSA | 97.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.30 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-[6-[1,4-dimethyl-5-(trifluoromethyl)pyrazol-3-yl]oxybenzotriazol-1-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-[1,4-dimethyl-5-(trifluoromethyl)pyrazol-3-yl]oxybenzotriazol-1-yl]propanoate?
The IUPAC name of 2-[6-[1,4-dimethyl-5-(trifluoromethyl)pyrazol-3-yl]oxybenzotriazol-1-yl]propanoate (CID 19775933) is 2-[6-[1,4-dimethyl-5-(trifluoromethyl)pyrazol-3-yl]oxybenzotriazol-1-yl]propanoate.
What is the SMILES notation for 2-[6-[1,4-dimethyl-5-(trifluoromethyl)pyrazol-3-yl]oxybenzotriazol-1-yl]propanoate?
The canonical SMILES for 2-[6-[1,4-dimethyl-5-(trifluoromethyl)pyrazol-3-yl]oxybenzotriazol-1-yl]propanoate is Cc1c(Oc2ccc3nnn(C(C)C(=O)[O-])c3c2)nn(C)c1C(F)(F)F.
What is the InChIKey of 2-[6-[1,4-dimethyl-5-(trifluoromethyl)pyrazol-3-yl]oxybenzotriazol-1-yl]propanoate?
The InChIKey is JEQXDBUZNVEMPN-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H14F3N5O3/c1-7-12(15(16,17)18)22(3)20-13(7)26-9-4-5-10-11(6-9)23(21-19-10)8(2)14(24)25/h4-6,8H,1-3H3,(H,24,25)/p-1.
What are the key properties of 2-[6-[1,4-dimethyl-5-(trifluoromethyl)pyrazol-3-yl]oxybenzotriazol-1-yl]propanoate?
2-[6-[1,4-dimethyl-5-(trifluoromethyl)pyrazol-3-yl]oxybenzotriazol-1-yl]propanoate has a molecular weight of 368.30 g/mol, XLogP of 1.60, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-[1,4-dimethyl-5-(trifluoromethyl)pyrazol-3-yl]oxybenzotriazol-1-yl]propanoate is sourced from PubChem (CID 19775933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).