C14H10F20 — CID 19776036
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,9,9,10,10-nonadecafluoro-8-(1-fluoropropyl)undecane (PubChem CID 19776036) has the molecular formula C14H10F20 and a molecular weight of 558.19 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,9,9,10,10-nonadecafluoro-8-(1-fluoropropyl)undecane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,9,9,10,10-nonadecafluoro-8-(1-fluoropropyl)undecane |
|---|---|
| PubChem CID | 19776036 |
| Molecular Formula | C14H10F20 |
| Molecular Weight | 558.19 g/mol |
| Exact Mass | 558.05 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,9,9,10,10-nonadecafluoro-8-(1-fluoropropyl)undecane |
| SMILES | CCC(F)C(F)(C(F)(F)C(C)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C14H10F20/c1-3-4(15)7(20,9(23,24)6(2,18)19)10(25,26)12(29,30)14(33,34)13(31,32)11(27,28)8(21,22)5(16)17/h4-5H,3H2,1-2H3 |
| InChIKey | NSSPWLMGEGEHQC-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.19 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|