About (Z)-2-[(2,5-dioxopyrrol-1-yl)methyl]but-2-enedial
(Z)-2-[(2,5-dioxopyrrol-1-yl)methyl]but-2-enedial (PubChem CID 19776312) has the molecular formula C9H7NO4
and a molecular weight of 193.16 g/mol. Its IUPAC name is (Z)-2-[(2,5-dioxopyrrol-1-yl)methyl]but-2-enedial.
Molecular Properties
| Compound Name | (Z)-2-[(2,5-dioxopyrrol-1-yl)methyl]but-2-enedial |
| PubChem CID | 19776312 |
| Molecular Formula | C9H7NO4 |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | (Z)-2-[(2,5-dioxopyrrol-1-yl)methyl]but-2-enedial |
| SMILES | O=C/C=C(\C=O)CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C9H7NO4/c11-4-3-7(6-12)5-10-8(13)1-2-9(10)14/h1-4,6H,5H2/b7-3- |
| InChIKey | SIKMDSJSOOSMLG-CLTKARDFSA-N |
| XLogP | -0.76 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.16 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-[(2,5-dioxopyrrol-1-yl)methyl]but-2-enedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-[(2,5-dioxopyrrol-1-yl)methyl]but-2-enedial?
The IUPAC name of (Z)-2-[(2,5-dioxopyrrol-1-yl)methyl]but-2-enedial (CID 19776312) is (Z)-2-[(2,5-dioxopyrrol-1-yl)methyl]but-2-enedial.
What is the SMILES notation for (Z)-2-[(2,5-dioxopyrrol-1-yl)methyl]but-2-enedial?
The canonical SMILES for (Z)-2-[(2,5-dioxopyrrol-1-yl)methyl]but-2-enedial is O=C/C=C(\C=O)CN1C(=O)C=CC1=O.
What is the InChIKey of (Z)-2-[(2,5-dioxopyrrol-1-yl)methyl]but-2-enedial?
The InChIKey is SIKMDSJSOOSMLG-CLTKARDFSA-N. The full InChI is InChI=1S/C9H7NO4/c11-4-3-7(6-12)5-10-8(13)1-2-9(10)14/h1-4,6H,5H2/b7-3-.
What are the key properties of (Z)-2-[(2,5-dioxopyrrol-1-yl)methyl]but-2-enedial?
(Z)-2-[(2,5-dioxopyrrol-1-yl)methyl]but-2-enedial has a molecular weight of 193.16 g/mol, XLogP of -0.76, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-[(2,5-dioxopyrrol-1-yl)methyl]but-2-enedial is sourced from PubChem (CID 19776312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).