About 2-[4-(2-acetyloxyethyl)piperazin-1-yl]ethyl acetate;1-chloro-2-ethylbenzene
2-[4-(2-acetyloxyethyl)piperazin-1-yl]ethyl acetate;1-chloro-2-ethylbenzene (PubChem CID 19776566) has the molecular formula C20H31ClN2O4
and a molecular weight of 398.93 g/mol. Its IUPAC name is 2-[4-(2-acetyloxyethyl)piperazin-1-yl]ethyl acetate;1-chloro-2-ethylbenzene.
Molecular Properties
| Compound Name | 2-[4-(2-acetyloxyethyl)piperazin-1-yl]ethyl acetate;1-chloro-2-ethylbenzene |
| PubChem CID | 19776566 |
| Molecular Formula | C20H31ClN2O4 |
| Molecular Weight | 398.93 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 2-[4-(2-acetyloxyethyl)piperazin-1-yl]ethyl acetate;1-chloro-2-ethylbenzene |
| SMILES | CC(=O)OCCN1CCN(CCOC(C)=O)CC1.CCc1ccccc1Cl |
| InChI | InChI=1S/C12H22N2O4.C8H9Cl/c1-11(15)17-9-7-13-3-5-14(6-4-13)8-10-18-12(2)16;1-2-7-5-3-4-6-8(7)9/h3-10H2,1-2H3;3-6H,2H2,1H3 |
| InChIKey | ZMXZZGNZCQDWEH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.93 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4-(2-acetyloxyethyl)piperazin-1-yl]ethyl acetate;1-chloro-2-ethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-acetyloxyethyl)piperazin-1-yl]ethyl acetate;1-chloro-2-ethylbenzene?
The IUPAC name of 2-[4-(2-acetyloxyethyl)piperazin-1-yl]ethyl acetate;1-chloro-2-ethylbenzene (CID 19776566) is 2-[4-(2-acetyloxyethyl)piperazin-1-yl]ethyl acetate;1-chloro-2-ethylbenzene.
What is the SMILES notation for 2-[4-(2-acetyloxyethyl)piperazin-1-yl]ethyl acetate;1-chloro-2-ethylbenzene?
The canonical SMILES for 2-[4-(2-acetyloxyethyl)piperazin-1-yl]ethyl acetate;1-chloro-2-ethylbenzene is CC(=O)OCCN1CCN(CCOC(C)=O)CC1.CCc1ccccc1Cl.
What is the InChIKey of 2-[4-(2-acetyloxyethyl)piperazin-1-yl]ethyl acetate;1-chloro-2-ethylbenzene?
The InChIKey is ZMXZZGNZCQDWEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O4.C8H9Cl/c1-11(15)17-9-7-13-3-5-14(6-4-13)8-10-18-12(2)16;1-2-7-5-3-4-6-8(7)9/h3-10H2,1-2H3;3-6H,2H2,1H3.
What are the key properties of 2-[4-(2-acetyloxyethyl)piperazin-1-yl]ethyl acetate;1-chloro-2-ethylbenzene?
2-[4-(2-acetyloxyethyl)piperazin-1-yl]ethyl acetate;1-chloro-2-ethylbenzene has a molecular weight of 398.93 g/mol, XLogP of 2.63, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-acetyloxyethyl)piperazin-1-yl]ethyl acetate;1-chloro-2-ethylbenzene is sourced from PubChem (CID 19776566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).