C18H17N5O5 — CID 19776611
7-(3-aminopyrrolidin-1-yl)-8-cyano-1-cyclopropyl-6-nitro-4-oxoquinoline-3-carboxylic acid (PubChem CID 19776611) has the molecular formula C18H17N5O5 and a molecular weight of 383.36 g/mol. Its IUPAC name is 7-(3-aminopyrrolidin-1-yl)-8-cyano-1-cyclopropyl-6-nitro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-(3-aminopyrrolidin-1-yl)-8-cyano-1-cyclopropyl-6-nitro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 19776611 |
| Molecular Formula | C18H17N5O5 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 7-(3-aminopyrrolidin-1-yl)-8-cyano-1-cyclopropyl-6-nitro-4-oxoquinoline-3-carboxylic acid |
| SMILES | N#Cc1c(N2CCC(N)C2)c([N+](=O)[O-])cc2c(=O)c(C(=O)O)cn(C3CC3)c12 |
| InChI | InChI=1S/C18H17N5O5/c19-6-12-15-11(17(24)13(18(25)26)8-22(15)10-1-2-10)5-14(23(27)28)16(12)21-4-3-9(20)7-21/h5,8-10H,1-4,7,20H2,(H,25,26) |
| InChIKey | PYIFNYNYIAXUEL-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 155.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|