About ethyl N-(imino-λ4-sulfanylidene)carbamate
ethyl N-(imino-λ4-sulfanylidene)carbamate (PubChem CID 19777031) has the molecular formula C3H6N2O2S
and a molecular weight of 134.16 g/mol. Its IUPAC name is ethyl N-(imino-λ4-sulfanylidene)carbamate.
Molecular Properties
| Compound Name | ethyl N-(imino-λ4-sulfanylidene)carbamate |
| PubChem CID | 19777031 |
| Molecular Formula | C3H6N2O2S |
| Molecular Weight | 134.16 g/mol |
| Exact Mass | 134.01 |
| IUPAC Name | ethyl N-(imino-λ4-sulfanylidene)carbamate |
| SMILES | CCOC(=O)N=S=N |
| InChI | InChI=1S/C3H6N2O2S/c1-2-7-3(6)5-8-4/h4H,2H2,1H3 |
| InChIKey | HVKXHWFKHBQRKY-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 62.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.16 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl N-(imino-λ4-sulfanylidene)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-(imino-λ4-sulfanylidene)carbamate?
The IUPAC name of ethyl N-(imino-λ4-sulfanylidene)carbamate (CID 19777031) is ethyl N-(imino-λ4-sulfanylidene)carbamate.
What is the SMILES notation for ethyl N-(imino-λ4-sulfanylidene)carbamate?
The canonical SMILES for ethyl N-(imino-λ4-sulfanylidene)carbamate is CCOC(=O)N=S=N.
What is the InChIKey of ethyl N-(imino-λ4-sulfanylidene)carbamate?
The InChIKey is HVKXHWFKHBQRKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N2O2S/c1-2-7-3(6)5-8-4/h4H,2H2,1H3.
What are the key properties of ethyl N-(imino-λ4-sulfanylidene)carbamate?
ethyl N-(imino-λ4-sulfanylidene)carbamate has a molecular weight of 134.16 g/mol, XLogP of 1.17, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-(imino-λ4-sulfanylidene)carbamate is sourced from PubChem (CID 19777031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).