C16H10F2N2O3S — CID 19777242
ethyl 9,10-difluoro-14-methylimino-6-oxo-3-thia-13-azatetracyclo[9.2.1.04,13.07,12]tetradeca-1,4,7,9,11-pentaene-5-carboxylate (PubChem CID 19777242) has the molecular formula C16H10F2N2O3S and a molecular weight of 348.33 g/mol. Its IUPAC name is ethyl 9,10-difluoro-14-methylimino-6-oxo-3-thia-13-azatetracyclo[9.2.1.04,13.07,12]tetradeca-1,4,7,9,11-pentaene-5-carboxylate.
| Compound Name | ethyl 9,10-difluoro-14-methylimino-6-oxo-3-thia-13-azatetracyclo[9.2.1.04,13.07,12]tetradeca-1,4,7,9,11-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 19777242 |
| Molecular Formula | C16H10F2N2O3S |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | ethyl 9,10-difluoro-14-methylimino-6-oxo-3-thia-13-azatetracyclo[9.2.1.04,13.07,12]tetradeca-1,4,7,9,11-pentaene-5-carboxylate |
| SMILES | CCOC(=O)c1c(=O)c2cc(F)c(F)c3/c(=N/C)c4csc1n4c23 |
| InChI | InChI=1S/C16H10F2N2O3S/c1-3-23-16(22)10-14(21)6-4-7(17)11(18)9-12(19-2)8-5-24-15(10)20(8)13(6)9/h4-5H,3H2,1-2H3/b19-12+ |
| InChIKey | HQQCWXSTFAZEPH-XDHOZWIPSA-N |
| XLogP | 2.53 |
| TPSA | 60.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |