C9H14NO3S- — CID 19777315
3-formyl-2,2,5,5-tetramethyl-1,3-thiazolidine-4-carboxylate (PubChem CID 19777315) has the molecular formula C9H14NO3S- and a molecular weight of 216.28 g/mol. Its IUPAC name is 3-formyl-2,2,5,5-tetramethyl-1,3-thiazolidine-4-carboxylate.
| Compound Name | 3-formyl-2,2,5,5-tetramethyl-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 19777315 |
| Molecular Formula | C9H14NO3S- |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 3-formyl-2,2,5,5-tetramethyl-1,3-thiazolidine-4-carboxylate |
| SMILES | CC1(C)SC(C)(C)N(C=O)C1C(=O)[O-] |
| InChI | InChI=1S/C9H15NO3S/c1-8(2)6(7(12)13)10(5-11)9(3,4)14-8/h5-6H,1-4H3,(H,12,13)/p-1 |
| InChIKey | QEIKJZZSMZXSAI-UHFFFAOYSA-M |
| XLogP | -0.18 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|