About ethyl 2-(N-[2-(2,4-difluorophenyl)acetyl]-4-fluoroanilino)acetate
ethyl 2-(N-[2-(2,4-difluorophenyl)acetyl]-4-fluoroanilino)acetate (PubChem CID 19777343) has the molecular formula C18H16F3NO3
and a molecular weight of 351.32 g/mol. Its IUPAC name is ethyl 2-(N-[2-(2,4-difluorophenyl)acetyl]-4-fluoroanilino)acetate.
Molecular Properties
| Compound Name | ethyl 2-(N-[2-(2,4-difluorophenyl)acetyl]-4-fluoroanilino)acetate |
| PubChem CID | 19777343 |
| Molecular Formula | C18H16F3NO3 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | ethyl 2-(N-[2-(2,4-difluorophenyl)acetyl]-4-fluoroanilino)acetate |
| SMILES | CCOC(=O)CN(C(=O)Cc1ccc(F)cc1F)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H16F3NO3/c1-2-25-18(24)11-22(15-7-5-13(19)6-8-15)17(23)9-12-3-4-14(20)10-16(12)21/h3-8,10H,2,9,11H2,1H3 |
| InChIKey | LRCGJFGJJFGTGL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-(N-[2-(2,4-difluorophenyl)acetyl]-4-fluoroanilino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(N-[2-(2,4-difluorophenyl)acetyl]-4-fluoroanilino)acetate?
The IUPAC name of ethyl 2-(N-[2-(2,4-difluorophenyl)acetyl]-4-fluoroanilino)acetate (CID 19777343) is ethyl 2-(N-[2-(2,4-difluorophenyl)acetyl]-4-fluoroanilino)acetate.
What is the SMILES notation for ethyl 2-(N-[2-(2,4-difluorophenyl)acetyl]-4-fluoroanilino)acetate?
The canonical SMILES for ethyl 2-(N-[2-(2,4-difluorophenyl)acetyl]-4-fluoroanilino)acetate is CCOC(=O)CN(C(=O)Cc1ccc(F)cc1F)c1ccc(F)cc1.
What is the InChIKey of ethyl 2-(N-[2-(2,4-difluorophenyl)acetyl]-4-fluoroanilino)acetate?
The InChIKey is LRCGJFGJJFGTGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16F3NO3/c1-2-25-18(24)11-22(15-7-5-13(19)6-8-15)17(23)9-12-3-4-14(20)10-16(12)21/h3-8,10H,2,9,11H2,1H3.
What are the key properties of ethyl 2-(N-[2-(2,4-difluorophenyl)acetyl]-4-fluoroanilino)acetate?
ethyl 2-(N-[2-(2,4-difluorophenyl)acetyl]-4-fluoroanilino)acetate has a molecular weight of 351.32 g/mol, XLogP of 3.24, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(N-[2-(2,4-difluorophenyl)acetyl]-4-fluoroanilino)acetate is sourced from PubChem (CID 19777343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).