About 1-[4-[6-(2,3-dichloro-5,6-dihydroxyphenyl)hexoxy]-2-hydroxy-3-propylphenyl]ethanone
1-[4-[6-(2,3-dichloro-5,6-dihydroxyphenyl)hexoxy]-2-hydroxy-3-propylphenyl]ethanone (PubChem CID 19777422) has the molecular formula C23H28Cl2O5
and a molecular weight of 455.38 g/mol. Its IUPAC name is 1-[4-[6-(2,3-dichloro-5,6-dihydroxyphenyl)hexoxy]-2-hydroxy-3-propylphenyl]ethanone.
Molecular Properties
| Compound Name | 1-[4-[6-(2,3-dichloro-5,6-dihydroxyphenyl)hexoxy]-2-hydroxy-3-propylphenyl]ethanone |
| PubChem CID | 19777422 |
| Molecular Formula | C23H28Cl2O5 |
| Molecular Weight | 455.38 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 1-[4-[6-(2,3-dichloro-5,6-dihydroxyphenyl)hexoxy]-2-hydroxy-3-propylphenyl]ethanone |
| SMILES | CCCc1c(OCCCCCCc2c(O)c(O)cc(Cl)c2Cl)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C23H28Cl2O5/c1-3-8-16-20(11-10-15(14(2)26)22(16)28)30-12-7-5-4-6-9-17-21(25)18(24)13-19(27)23(17)29/h10-11,13,27-29H,3-9,12H2,1-2H3 |
| InChIKey | UTYUKJISXQLQNT-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.38 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[6-(2,3-dichloro-5,6-dihydroxyphenyl)hexoxy]-2-hydroxy-3-propylphenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[6-(2,3-dichloro-5,6-dihydroxyphenyl)hexoxy]-2-hydroxy-3-propylphenyl]ethanone?
The IUPAC name of 1-[4-[6-(2,3-dichloro-5,6-dihydroxyphenyl)hexoxy]-2-hydroxy-3-propylphenyl]ethanone (CID 19777422) is 1-[4-[6-(2,3-dichloro-5,6-dihydroxyphenyl)hexoxy]-2-hydroxy-3-propylphenyl]ethanone.
What is the SMILES notation for 1-[4-[6-(2,3-dichloro-5,6-dihydroxyphenyl)hexoxy]-2-hydroxy-3-propylphenyl]ethanone?
The canonical SMILES for 1-[4-[6-(2,3-dichloro-5,6-dihydroxyphenyl)hexoxy]-2-hydroxy-3-propylphenyl]ethanone is CCCc1c(OCCCCCCc2c(O)c(O)cc(Cl)c2Cl)ccc(C(C)=O)c1O.
What is the InChIKey of 1-[4-[6-(2,3-dichloro-5,6-dihydroxyphenyl)hexoxy]-2-hydroxy-3-propylphenyl]ethanone?
The InChIKey is UTYUKJISXQLQNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28Cl2O5/c1-3-8-16-20(11-10-15(14(2)26)22(16)28)30-12-7-5-4-6-9-17-21(25)18(24)13-19(27)23(17)29/h10-11,13,27-29H,3-9,12H2,1-2H3.
What are the key properties of 1-[4-[6-(2,3-dichloro-5,6-dihydroxyphenyl)hexoxy]-2-hydroxy-3-propylphenyl]ethanone?
1-[4-[6-(2,3-dichloro-5,6-dihydroxyphenyl)hexoxy]-2-hydroxy-3-propylphenyl]ethanone has a molecular weight of 455.38 g/mol, XLogP of 6.45, 11 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[6-(2,3-dichloro-5,6-dihydroxyphenyl)hexoxy]-2-hydroxy-3-propylphenyl]ethanone is sourced from PubChem (CID 19777422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).