About 3-[2-chloro-1,2-bis(prop-2-enoxy)ethoxy]prop-1-ene
3-[2-chloro-1,2-bis(prop-2-enoxy)ethoxy]prop-1-ene (PubChem CID 19777599) has the molecular formula C11H17ClO3
and a molecular weight of 232.71 g/mol. Its IUPAC name is 3-[2-chloro-1,2-bis(prop-2-enoxy)ethoxy]prop-1-ene.
Molecular Properties
| Compound Name | 3-[2-chloro-1,2-bis(prop-2-enoxy)ethoxy]prop-1-ene |
| PubChem CID | 19777599 |
| Molecular Formula | C11H17ClO3 |
| Molecular Weight | 232.71 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 3-[2-chloro-1,2-bis(prop-2-enoxy)ethoxy]prop-1-ene |
| SMILES | C=CCOC(Cl)C(OCC=C)OCC=C |
| InChI | InChI=1S/C11H17ClO3/c1-4-7-13-10(12)11(14-8-5-2)15-9-6-3/h4-6,10-11H,1-3,7-9H2 |
| InChIKey | BUBSVYLIGKZTDF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.71 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-chloro-1,2-bis(prop-2-enoxy)ethoxy]prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-chloro-1,2-bis(prop-2-enoxy)ethoxy]prop-1-ene?
The IUPAC name of 3-[2-chloro-1,2-bis(prop-2-enoxy)ethoxy]prop-1-ene (CID 19777599) is 3-[2-chloro-1,2-bis(prop-2-enoxy)ethoxy]prop-1-ene.
What is the SMILES notation for 3-[2-chloro-1,2-bis(prop-2-enoxy)ethoxy]prop-1-ene?
The canonical SMILES for 3-[2-chloro-1,2-bis(prop-2-enoxy)ethoxy]prop-1-ene is C=CCOC(Cl)C(OCC=C)OCC=C.
What is the InChIKey of 3-[2-chloro-1,2-bis(prop-2-enoxy)ethoxy]prop-1-ene?
The InChIKey is BUBSVYLIGKZTDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17ClO3/c1-4-7-13-10(12)11(14-8-5-2)15-9-6-3/h4-6,10-11H,1-3,7-9H2.
What are the key properties of 3-[2-chloro-1,2-bis(prop-2-enoxy)ethoxy]prop-1-ene?
3-[2-chloro-1,2-bis(prop-2-enoxy)ethoxy]prop-1-ene has a molecular weight of 232.71 g/mol, XLogP of 2.49, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-chloro-1,2-bis(prop-2-enoxy)ethoxy]prop-1-ene is sourced from PubChem (CID 19777599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).