About N-butylprop-2-enamide;N-propylpropan-1-amine
N-butylprop-2-enamide;N-propylpropan-1-amine (PubChem CID 19778529) has the molecular formula C13H28N2O
and a molecular weight of 228.38 g/mol. Its IUPAC name is N-butylprop-2-enamide;N-propylpropan-1-amine.
Molecular Properties
| Compound Name | N-butylprop-2-enamide;N-propylpropan-1-amine |
| PubChem CID | 19778529 |
| Molecular Formula | C13H28N2O |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.22 |
| IUPAC Name | N-butylprop-2-enamide;N-propylpropan-1-amine |
| SMILES | C=CC(=O)NCCCC.CCCNCCC |
| InChI | InChI=1S/C7H13NO.C6H15N/c1-3-5-6-8-7(9)4-2;1-3-5-7-6-4-2/h4H,2-3,5-6H2,1H3,(H,8,9);7H,3-6H2,1-2H3 |
| InChIKey | GOSPOQIROIBXDV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-butylprop-2-enamide;N-propylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butylprop-2-enamide;N-propylpropan-1-amine?
The IUPAC name of N-butylprop-2-enamide;N-propylpropan-1-amine (CID 19778529) is N-butylprop-2-enamide;N-propylpropan-1-amine.
What is the SMILES notation for N-butylprop-2-enamide;N-propylpropan-1-amine?
The canonical SMILES for N-butylprop-2-enamide;N-propylpropan-1-amine is C=CC(=O)NCCCC.CCCNCCC.
What is the InChIKey of N-butylprop-2-enamide;N-propylpropan-1-amine?
The InChIKey is GOSPOQIROIBXDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO.C6H15N/c1-3-5-6-8-7(9)4-2;1-3-5-7-6-4-2/h4H,2-3,5-6H2,1H3,(H,8,9);7H,3-6H2,1-2H3.
What are the key properties of N-butylprop-2-enamide;N-propylpropan-1-amine?
N-butylprop-2-enamide;N-propylpropan-1-amine has a molecular weight of 228.38 g/mol, XLogP of 2.48, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butylprop-2-enamide;N-propylpropan-1-amine is sourced from PubChem (CID 19778529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).