C38H20F6O10 — CID 19778558
12,14-diphenyl-12,14-bis(trifluoromethyl)chromeno[3,2-b]xanthene-2,3,9,10-tetracarboxylic acid (PubChem CID 19778558) has the molecular formula C38H20F6O10 and a molecular weight of 750.56 g/mol. Its IUPAC name is 12,14-diphenyl-12,14-bis(trifluoromethyl)chromeno[3,2-b]xanthene-2,3,9,10-tetracarboxylic acid.
| Compound Name | 12,14-diphenyl-12,14-bis(trifluoromethyl)chromeno[3,2-b]xanthene-2,3,9,10-tetracarboxylic acid |
|---|---|
| PubChem CID | 19778558 |
| Molecular Formula | C38H20F6O10 |
| Molecular Weight | 750.56 g/mol |
| Exact Mass | 750.10 |
| IUPAC Name | 12,14-diphenyl-12,14-bis(trifluoromethyl)chromeno[3,2-b]xanthene-2,3,9,10-tetracarboxylic acid |
| SMILES | O=C(O)c1cc2c(cc1C(=O)O)C(c1ccccc1)(C(F)(F)F)c1cc3c(cc1O2)Oc1cc(C(=O)O)c(C(=O)O)cc1C3(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C38H20F6O10/c39-37(40,41)35(17-7-3-1-4-8-17)23-11-19(31(45)46)21(33(49)50)13-27(23)53-29-16-30-26(15-25(29)35)36(38(42,43)44,18-9-5-2-6-10-18)24-12-20(32(47)48)22(34(51)52)14-28(24)54-30/h1-16H,(H,45,46)(H,47,48)(H,49,50)(H,51,52) |
| InChIKey | CJSYRBGWKQQVOW-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.56 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |