C40H20F10O10 — CID 19778565
12,14-bis(1,1,2,2,2-pentafluoroethyl)-12,14-diphenylchromeno[3,2-b]xanthene-2,3,9,10-tetracarboxylic acid (PubChem CID 19778565) has the molecular formula C40H20F10O10 and a molecular weight of 850.57 g/mol. Its IUPAC name is 12,14-bis(1,1,2,2,2-pentafluoroethyl)-12,14-diphenylchromeno[3,2-b]xanthene-2,3,9,10-tetracarboxylic acid.
| Compound Name | 12,14-bis(1,1,2,2,2-pentafluoroethyl)-12,14-diphenylchromeno[3,2-b]xanthene-2,3,9,10-tetracarboxylic acid |
|---|---|
| PubChem CID | 19778565 |
| Molecular Formula | C40H20F10O10 |
| Molecular Weight | 850.57 g/mol |
| Exact Mass | 850.09 |
| IUPAC Name | 12,14-bis(1,1,2,2,2-pentafluoroethyl)-12,14-diphenylchromeno[3,2-b]xanthene-2,3,9,10-tetracarboxylic acid |
| SMILES | O=C(O)c1cc2c(cc1C(=O)O)C(c1ccccc1)(C(F)(F)C(F)(F)F)c1cc3c(cc1O2)Oc1cc(C(=O)O)c(C(=O)O)cc1C3(c1ccccc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C40H20F10O10/c41-37(42,39(45,46)47)35(17-7-3-1-4-8-17)23-11-19(31(51)52)21(33(55)56)13-27(23)59-29-16-30-26(15-25(29)35)36(18-9-5-2-6-10-18,38(43,44)40(48,49)50)24-12-20(32(53)54)22(34(57)58)14-28(24)60-30/h1-16H,(H,51,52)(H,53,54)(H,55,56)(H,57,58) |
| InChIKey | CYECVKROMSHPDJ-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.57 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|