About 2-butoxybut-3-en-1-ol;(E)-4-butoxybut-2-en-1-ol
2-butoxybut-3-en-1-ol;(E)-4-butoxybut-2-en-1-ol (PubChem CID 19778737) has the molecular formula C16H32O4
and a molecular weight of 288.43 g/mol. Its IUPAC name is 2-butoxybut-3-en-1-ol;(E)-4-butoxybut-2-en-1-ol.
Molecular Properties
| Compound Name | 2-butoxybut-3-en-1-ol;(E)-4-butoxybut-2-en-1-ol |
| PubChem CID | 19778737 |
| Molecular Formula | C16H32O4 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | 2-butoxybut-3-en-1-ol;(E)-4-butoxybut-2-en-1-ol |
| SMILES | C=CC(CO)OCCCC.CCCCOC/C=C/CO |
| InChI | InChI=1S/2C8H16O2/c1-3-5-6-10-8(4-2)7-9;1-2-3-7-10-8-5-4-6-9/h4,8-9H,2-3,5-7H2,1H3;4-5,9H,2-3,6-8H2,1H3/b;5-4+ |
| InChIKey | QXVMPSAKTDOISQ-RCKHEGBHSA-N |
| XLogP | 2.70 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxybut-3-en-1-ol;(E)-4-butoxybut-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxybut-3-en-1-ol;(E)-4-butoxybut-2-en-1-ol?
The IUPAC name of 2-butoxybut-3-en-1-ol;(E)-4-butoxybut-2-en-1-ol (CID 19778737) is 2-butoxybut-3-en-1-ol;(E)-4-butoxybut-2-en-1-ol.
What is the SMILES notation for 2-butoxybut-3-en-1-ol;(E)-4-butoxybut-2-en-1-ol?
The canonical SMILES for 2-butoxybut-3-en-1-ol;(E)-4-butoxybut-2-en-1-ol is C=CC(CO)OCCCC.CCCCOC/C=C/CO.
What is the InChIKey of 2-butoxybut-3-en-1-ol;(E)-4-butoxybut-2-en-1-ol?
The InChIKey is QXVMPSAKTDOISQ-RCKHEGBHSA-N. The full InChI is InChI=1S/2C8H16O2/c1-3-5-6-10-8(4-2)7-9;1-2-3-7-10-8-5-4-6-9/h4,8-9H,2-3,5-7H2,1H3;4-5,9H,2-3,6-8H2,1H3/b;5-4+.
What are the key properties of 2-butoxybut-3-en-1-ol;(E)-4-butoxybut-2-en-1-ol?
2-butoxybut-3-en-1-ol;(E)-4-butoxybut-2-en-1-ol has a molecular weight of 288.43 g/mol, XLogP of 2.70, 12 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxybut-3-en-1-ol;(E)-4-butoxybut-2-en-1-ol is sourced from PubChem (CID 19778737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).