C8H10F3N5O2 — CID 19778827
1-N,1-N-diamino-2-nitro-3-(2,2,2-trifluoroethyl)benzene-1,4-diamine (PubChem CID 19778827) has the molecular formula C8H10F3N5O2 and a molecular weight of 265.19 g/mol. Its IUPAC name is 1-N,1-N-diamino-2-nitro-3-(2,2,2-trifluoroethyl)benzene-1,4-diamine.
| Compound Name | 1-N,1-N-diamino-2-nitro-3-(2,2,2-trifluoroethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 19778827 |
| Molecular Formula | C8H10F3N5O2 |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 1-N,1-N-diamino-2-nitro-3-(2,2,2-trifluoroethyl)benzene-1,4-diamine |
| SMILES | Nc1ccc(N(N)N)c([N+](=O)[O-])c1CC(F)(F)F |
| InChI | InChI=1S/C8H10F3N5O2/c9-8(10,11)3-4-5(12)1-2-6(15(13)14)7(4)16(17)18/h1-2H,3,12-14H2 |
| InChIKey | UATJOTGQEVYFTF-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|