C12H11N3O5 — CID 19778876
2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]-6-hydroxybenzaldehyde (PubChem CID 19778876) has the molecular formula C12H11N3O5 and a molecular weight of 277.24 g/mol. Its IUPAC name is 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]-6-hydroxybenzaldehyde.
| Compound Name | 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]-6-hydroxybenzaldehyde |
|---|---|
| PubChem CID | 19778876 |
| Molecular Formula | C12H11N3O5 |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]-6-hydroxybenzaldehyde |
| SMILES | COc1nc(OC)nc(Oc2cccc(O)c2C=O)n1 |
| InChI | InChI=1S/C12H11N3O5/c1-18-10-13-11(19-2)15-12(14-10)20-9-5-3-4-8(17)7(9)6-16/h3-6,17H,1-2H3 |
| InChIKey | WSCDPLHYRZJQOP-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 103.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|