About CID 19779978
CID 19779978 (PubChem CID 19779978) has the molecular formula C6H14ClO2Si
and a molecular weight of 181.71 g/mol.
Molecular Properties
| Compound Name | CID 19779978 |
| PubChem CID | 19779978 |
| Molecular Formula | C6H14ClO2Si |
| Molecular Weight | 181.71 g/mol |
| Exact Mass | 181.05 |
| IUPAC Name | — |
| SMILES | CCC(Cl)C[Si](OC)OC |
| InChI | InChI=1S/C6H14ClO2Si/c1-4-6(7)5-10(8-2)9-3/h6H,4-5H2,1-3H3 |
| InChIKey | CSDNQUUXVPORLC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.71 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 19779978 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 19779978?
The IUPAC name of CID 19779978 (CID 19779978) is not available.
What is the SMILES notation for CID 19779978?
The canonical SMILES for CID 19779978 is CCC(Cl)C[Si](OC)OC.
What is the InChIKey of CID 19779978?
The InChIKey is CSDNQUUXVPORLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14ClO2Si/c1-4-6(7)5-10(8-2)9-3/h6H,4-5H2,1-3H3.
What are the key properties of CID 19779978?
CID 19779978 has a molecular weight of 181.71 g/mol, XLogP of 1.78, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 19779978 is sourced from PubChem (CID 19779978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).