About 5-tridecyl-1,2,4-oxadiazol-3-amine
5-tridecyl-1,2,4-oxadiazol-3-amine (PubChem CID 19780334) has the molecular formula C15H29N3O
and a molecular weight of 267.42 g/mol. Its IUPAC name is 5-tridecyl-1,2,4-oxadiazol-3-amine.
Molecular Properties
| Compound Name | 5-tridecyl-1,2,4-oxadiazol-3-amine |
| PubChem CID | 19780334 |
| Molecular Formula | C15H29N3O |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.23 |
| IUPAC Name | 5-tridecyl-1,2,4-oxadiazol-3-amine |
| SMILES | CCCCCCCCCCCCCc1nc(N)no1 |
| InChI | InChI=1S/C15H29N3O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17-15(16)18-19-14/h2-13H2,1H3,(H2,16,18) |
| InChIKey | ZWPCHESIQKVQMT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-tridecyl-1,2,4-oxadiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tridecyl-1,2,4-oxadiazol-3-amine?
The IUPAC name of 5-tridecyl-1,2,4-oxadiazol-3-amine (CID 19780334) is 5-tridecyl-1,2,4-oxadiazol-3-amine.
What is the SMILES notation for 5-tridecyl-1,2,4-oxadiazol-3-amine?
The canonical SMILES for 5-tridecyl-1,2,4-oxadiazol-3-amine is CCCCCCCCCCCCCc1nc(N)no1.
What is the InChIKey of 5-tridecyl-1,2,4-oxadiazol-3-amine?
The InChIKey is ZWPCHESIQKVQMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29N3O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17-15(16)18-19-14/h2-13H2,1H3,(H2,16,18).
What are the key properties of 5-tridecyl-1,2,4-oxadiazol-3-amine?
5-tridecyl-1,2,4-oxadiazol-3-amine has a molecular weight of 267.42 g/mol, XLogP of 4.51, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tridecyl-1,2,4-oxadiazol-3-amine is sourced from PubChem (CID 19780334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).