C20H22N2 — CID 19780368
N,N-diethyl-6-methyl-5,10-dihydroindeno[1,2-b]indol-8-amine (PubChem CID 19780368) has the molecular formula C20H22N2 and a molecular weight of 290.41 g/mol. Its IUPAC name is N,N-diethyl-6-methyl-5,10-dihydroindeno[1,2-b]indol-8-amine.
| Compound Name | N,N-diethyl-6-methyl-5,10-dihydroindeno[1,2-b]indol-8-amine |
|---|---|
| PubChem CID | 19780368 |
| Molecular Formula | C20H22N2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | N,N-diethyl-6-methyl-5,10-dihydroindeno[1,2-b]indol-8-amine |
| SMILES | CCN(CC)c1cc(C)c2[nH]c3c(c2c1)Cc1ccccc1-3 |
| InChI | InChI=1S/C20H22N2/c1-4-22(5-2)15-10-13(3)19-18(12-15)17-11-14-8-6-7-9-16(14)20(17)21-19/h6-10,12,21H,4-5,11H2,1-3H3 |
| InChIKey | VNMUKPXDWQJRAO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |