C16H10F6N2O3 — CID 19780769
1-[2-amino-5-[4-amino-3-(2,2,2-trifluoroacetyl)phenoxy]phenyl]-2,2,2-trifluoroethanone (PubChem CID 19780769) has the molecular formula C16H10F6N2O3 and a molecular weight of 392.26 g/mol. Its IUPAC name is 1-[2-amino-5-[4-amino-3-(2,2,2-trifluoroacetyl)phenoxy]phenyl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[2-amino-5-[4-amino-3-(2,2,2-trifluoroacetyl)phenoxy]phenyl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 19780769 |
| Molecular Formula | C16H10F6N2O3 |
| Molecular Weight | 392.26 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 1-[2-amino-5-[4-amino-3-(2,2,2-trifluoroacetyl)phenoxy]phenyl]-2,2,2-trifluoroethanone |
| SMILES | Nc1ccc(Oc2ccc(N)c(C(=O)C(F)(F)F)c2)cc1C(=O)C(F)(F)F |
| InChI | InChI=1S/C16H10F6N2O3/c17-15(18,19)13(25)9-5-7(1-3-11(9)23)27-8-2-4-12(24)10(6-8)14(26)16(20,21)22/h1-6H,23-24H2 |
| InChIKey | REQWCJPDXMLHFN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.26 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|