C17H32O2 — CID 19780774
6-(3,3-diethoxybutyl)-1,5,5-trimethylcyclohexene (PubChem CID 19780774) has the molecular formula C17H32O2 and a molecular weight of 268.44 g/mol. Its IUPAC name is 6-(3,3-diethoxybutyl)-1,5,5-trimethylcyclohexene.
| Compound Name | 6-(3,3-diethoxybutyl)-1,5,5-trimethylcyclohexene |
|---|---|
| PubChem CID | 19780774 |
| Molecular Formula | C17H32O2 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | 6-(3,3-diethoxybutyl)-1,5,5-trimethylcyclohexene |
| SMILES | CCOC(C)(CCC1C(C)=CCCC1(C)C)OCC |
| InChI | InChI=1S/C17H32O2/c1-7-18-17(6,19-8-2)13-11-15-14(3)10-9-12-16(15,4)5/h10,15H,7-9,11-13H2,1-6H3 |
| InChIKey | UJJYIMKQMHDXGX-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|