About 6-[2-(6-tert-butyl-2,2-dimethyl-5-nitro-3H-1-benzofuran-7-yl)ethyl]-4-hydroxyoxan-2-one
6-[2-(6-tert-butyl-2,2-dimethyl-5-nitro-3H-1-benzofuran-7-yl)ethyl]-4-hydroxyoxan-2-one (PubChem CID 19781064) has the molecular formula C21H29NO6
and a molecular weight of 391.46 g/mol. Its IUPAC name is 6-[2-(6-tert-butyl-2,2-dimethyl-5-nitro-3H-1-benzofuran-7-yl)ethyl]-4-hydroxyoxan-2-one.
Molecular Properties
| Compound Name | 6-[2-(6-tert-butyl-2,2-dimethyl-5-nitro-3H-1-benzofuran-7-yl)ethyl]-4-hydroxyoxan-2-one |
| PubChem CID | 19781064 |
| Molecular Formula | C21H29NO6 |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 6-[2-(6-tert-butyl-2,2-dimethyl-5-nitro-3H-1-benzofuran-7-yl)ethyl]-4-hydroxyoxan-2-one |
| SMILES | CC1(C)Cc2cc([N+](=O)[O-])c(C(C)(C)C)c(CCC3CC(O)CC(=O)O3)c2O1 |
| InChI | InChI=1S/C21H29NO6/c1-20(2,3)18-15(7-6-14-9-13(23)10-17(24)27-14)19-12(8-16(18)22(25)26)11-21(4,5)28-19/h8,13-14,23H,6-7,9-11H2,1-5H3 |
| InChIKey | ASCNPVOYRHRAFZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-[2-(6-tert-butyl-2,2-dimethyl-5-nitro-3H-1-benzofuran-7-yl)ethyl]-4-hydroxyoxan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(6-tert-butyl-2,2-dimethyl-5-nitro-3H-1-benzofuran-7-yl)ethyl]-4-hydroxyoxan-2-one?
The IUPAC name of 6-[2-(6-tert-butyl-2,2-dimethyl-5-nitro-3H-1-benzofuran-7-yl)ethyl]-4-hydroxyoxan-2-one (CID 19781064) is 6-[2-(6-tert-butyl-2,2-dimethyl-5-nitro-3H-1-benzofuran-7-yl)ethyl]-4-hydroxyoxan-2-one.
What is the SMILES notation for 6-[2-(6-tert-butyl-2,2-dimethyl-5-nitro-3H-1-benzofuran-7-yl)ethyl]-4-hydroxyoxan-2-one?
The canonical SMILES for 6-[2-(6-tert-butyl-2,2-dimethyl-5-nitro-3H-1-benzofuran-7-yl)ethyl]-4-hydroxyoxan-2-one is CC1(C)Cc2cc([N+](=O)[O-])c(C(C)(C)C)c(CCC3CC(O)CC(=O)O3)c2O1.
What is the InChIKey of 6-[2-(6-tert-butyl-2,2-dimethyl-5-nitro-3H-1-benzofuran-7-yl)ethyl]-4-hydroxyoxan-2-one?
The InChIKey is ASCNPVOYRHRAFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29NO6/c1-20(2,3)18-15(7-6-14-9-13(23)10-17(24)27-14)19-12(8-16(18)22(25)26)11-21(4,5)28-19/h8,13-14,23H,6-7,9-11H2,1-5H3.
What are the key properties of 6-[2-(6-tert-butyl-2,2-dimethyl-5-nitro-3H-1-benzofuran-7-yl)ethyl]-4-hydroxyoxan-2-one?
6-[2-(6-tert-butyl-2,2-dimethyl-5-nitro-3H-1-benzofuran-7-yl)ethyl]-4-hydroxyoxan-2-one has a molecular weight of 391.46 g/mol, XLogP of 3.60, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(6-tert-butyl-2,2-dimethyl-5-nitro-3H-1-benzofuran-7-yl)ethyl]-4-hydroxyoxan-2-one is sourced from PubChem (CID 19781064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).