C22H29NO2 — CID 19781082
3-[5-(benzylamino)-2,2,4,6-tetramethyl-3H-1-benzofuran-7-yl]propan-1-ol (PubChem CID 19781082) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is 3-[5-(benzylamino)-2,2,4,6-tetramethyl-3H-1-benzofuran-7-yl]propan-1-ol.
| Compound Name | 3-[5-(benzylamino)-2,2,4,6-tetramethyl-3H-1-benzofuran-7-yl]propan-1-ol |
|---|---|
| PubChem CID | 19781082 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | 3-[5-(benzylamino)-2,2,4,6-tetramethyl-3H-1-benzofuran-7-yl]propan-1-ol |
| SMILES | Cc1c(CCCO)c2c(c(C)c1NCc1ccccc1)CC(C)(C)O2 |
| InChI | InChI=1S/C22H29NO2/c1-15-18(11-8-12-24)21-19(13-22(3,4)25-21)16(2)20(15)23-14-17-9-6-5-7-10-17/h5-7,9-10,23-24H,8,11-14H2,1-4H3 |
| InChIKey | UJVBPZPINIGUGE-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|