C24H33NO2 — CID 19781097
3-[5-(benzylamino)-2,2,4-trimethyl-6-propan-2-yl-3H-1-benzofuran-7-yl]propan-1-ol (PubChem CID 19781097) has the molecular formula C24H33NO2 and a molecular weight of 367.53 g/mol. Its IUPAC name is 3-[5-(benzylamino)-2,2,4-trimethyl-6-propan-2-yl-3H-1-benzofuran-7-yl]propan-1-ol.
| Compound Name | 3-[5-(benzylamino)-2,2,4-trimethyl-6-propan-2-yl-3H-1-benzofuran-7-yl]propan-1-ol |
|---|---|
| PubChem CID | 19781097 |
| Molecular Formula | C24H33NO2 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | 3-[5-(benzylamino)-2,2,4-trimethyl-6-propan-2-yl-3H-1-benzofuran-7-yl]propan-1-ol |
| SMILES | Cc1c2c(c(CCCO)c(C(C)C)c1NCc1ccccc1)OC(C)(C)C2 |
| InChI | InChI=1S/C24H33NO2/c1-16(2)21-19(12-9-13-26)23-20(14-24(4,5)27-23)17(3)22(21)25-15-18-10-7-6-8-11-18/h6-8,10-11,16,25-26H,9,12-15H2,1-5H3 |
| InChIKey | BEAMUBVRPIFDIN-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|