C24H28ClN3O3 — CID 19781149
2-[4-[2-(6-hydroxy-2,5-dimethyl-3,4-dihydrobenzo[h]chromen-2-yl)ethoxy]phenyl]guanidine;hydrochloride (PubChem CID 19781149) has the molecular formula C24H28ClN3O3 and a molecular weight of 441.96 g/mol. Its IUPAC name is 2-[4-[2-(6-hydroxy-2,5-dimethyl-3,4-dihydrobenzo[h]chromen-2-yl)ethoxy]phenyl]guanidine;hydrochloride.
| Compound Name | 2-[4-[2-(6-hydroxy-2,5-dimethyl-3,4-dihydrobenzo[h]chromen-2-yl)ethoxy]phenyl]guanidine;hydrochloride |
|---|---|
| PubChem CID | 19781149 |
| Molecular Formula | C24H28ClN3O3 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 2-[4-[2-(6-hydroxy-2,5-dimethyl-3,4-dihydrobenzo[h]chromen-2-yl)ethoxy]phenyl]guanidine;hydrochloride |
| SMILES | Cc1c2c(c3ccccc3c1O)OC(C)(CCOc1ccc(N=C(N)N)cc1)CC2.Cl |
| InChI | InChI=1S/C24H27N3O3.ClH/c1-15-18-11-12-24(2,30-22(18)20-6-4-3-5-19(20)21(15)28)13-14-29-17-9-7-16(8-10-17)27-23(25)26;/h3-10,28H,11-14H2,1-2H3,(H4,25,26,27);1H |
| InChIKey | ZASAMLKGPXOLIX-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|