C23H28F3N3O3 — CID 19781158
2-[4-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethoxy]-3-(trifluoromethyl)phenyl]guanidine (PubChem CID 19781158) has the molecular formula C23H28F3N3O3 and a molecular weight of 451.49 g/mol. Its IUPAC name is 2-[4-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethoxy]-3-(trifluoromethyl)phenyl]guanidine.
| Compound Name | 2-[4-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethoxy]-3-(trifluoromethyl)phenyl]guanidine |
|---|---|
| PubChem CID | 19781158 |
| Molecular Formula | C23H28F3N3O3 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 2-[4-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethoxy]-3-(trifluoromethyl)phenyl]guanidine |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(CCOc1ccc(N=C(N)N)cc1C(F)(F)F)O2 |
| InChI | InChI=1S/C23H28F3N3O3/c1-12-13(2)20-16(14(3)19(12)30)7-8-22(4,32-20)9-10-31-18-6-5-15(29-21(27)28)11-17(18)23(24,25)26/h5-6,11,30H,7-10H2,1-4H3,(H4,27,28,29) |
| InChIKey | PDVWQGNIOUNWLT-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|